C28H34BrN4O3S+ — CID 136940583
7-acetyl-10-bromo-6-(3,5-ditert-butyl-4-hydroxyphenyl)-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one (PubChem CID 136940583) has the molecular formula C28H34BrN4O3S+ and a molecular weight of 586.58 g/mol. Its IUPAC name is 7-acetyl-10-bromo-6-(3,5-ditert-butyl-4-hydroxyphenyl)-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one.
| Compound Name | 7-acetyl-10-bromo-6-(3,5-ditert-butyl-4-hydroxyphenyl)-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
|---|---|
| PubChem CID | 136940583 |
| Molecular Formula | C28H34BrN4O3S+ |
| Molecular Weight | 586.58 g/mol |
| Exact Mass | 585.15 |
| IUPAC Name | 7-acetyl-10-bromo-6-(3,5-ditert-butyl-4-hydroxyphenyl)-3-ethylsulfanyl-2,6-dihydro-[1,2,4]triazino[1,6-c]quinazolin-5-ium-1-one |
| SMILES | CCSc1n[n+]2c(c(=O)[nH]1)-c1cc(Br)ccc1N(C(C)=O)C2c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C28H33BrN4O3S/c1-9-37-26-30-24(36)22-18-14-17(29)10-11-21(18)32(15(2)34)25(33(22)31-26)16-12-19(27(3,4)5)23(35)20(13-16)28(6,7)8/h10-14,25H,9H2,1-8H3,(H-,30,31,35,36)/p+1 |
| InChIKey | SBMGWBTXAICASP-UHFFFAOYSA-O |
| XLogP | 5.81 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.58 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|