C9H14N4O4 — CID 136958754
2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-4-methoxybutanoic acid (PubChem CID 136958754) has the molecular formula C9H14N4O4 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-4-methoxybutanoic acid.
| Compound Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 136958754 |
| Molecular Formula | C9H14N4O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 2-[(5-amino-6-oxo-1H-pyrimidin-4-yl)amino]-4-methoxybutanoic acid |
| SMILES | COCCC(Nc1nc[nH]c(=O)c1N)C(=O)O |
| InChI | InChI=1S/C9H14N4O4/c1-17-3-2-5(9(15)16)13-7-6(10)8(14)12-4-11-7/h4-5H,2-3,10H2,1H3,(H,15,16)(H2,11,12,13,14) |
| InChIKey | BDGBAEOVPDFKNK-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |