C10H8F2N2O2 — CID 136968513
4-(3-amino-1,2-oxazol-5-yl)-2-(difluoromethyl)phenol (PubChem CID 136968513) has the molecular formula C10H8F2N2O2 and a molecular weight of 226.18 g/mol. Its IUPAC name is 4-(3-amino-1,2-oxazol-5-yl)-2-(difluoromethyl)phenol.
| Compound Name | 4-(3-amino-1,2-oxazol-5-yl)-2-(difluoromethyl)phenol |
|---|---|
| PubChem CID | 136968513 |
| Molecular Formula | C10H8F2N2O2 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 4-(3-amino-1,2-oxazol-5-yl)-2-(difluoromethyl)phenol |
| SMILES | Nc1cc(-c2ccc(O)c(C(F)F)c2)on1 |
| InChI | InChI=1S/C10H8F2N2O2/c11-10(12)6-3-5(1-2-7(6)15)8-4-9(13)14-16-8/h1-4,10,15H,(H2,13,14) |
| InChIKey | PFZNEVUWSIPGTJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |