C13H10N2O3 — CID 136952337
1-(3-amino-1,2-oxazol-5-yl)naphthalene-2,7-diol (PubChem CID 136952337) has the molecular formula C13H10N2O3 and a molecular weight of 242.23 g/mol. Its IUPAC name is 1-(3-amino-1,2-oxazol-5-yl)naphthalene-2,7-diol.
| Compound Name | 1-(3-amino-1,2-oxazol-5-yl)naphthalene-2,7-diol |
|---|---|
| PubChem CID | 136952337 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-(3-amino-1,2-oxazol-5-yl)naphthalene-2,7-diol |
| SMILES | Nc1cc(-c2c(O)ccc3ccc(O)cc23)on1 |
| InChI | InChI=1S/C13H10N2O3/c14-12-6-11(18-15-12)13-9-5-8(16)3-1-7(9)2-4-10(13)17/h1-6,16-17H,(H2,14,15) |
| InChIKey | GIPBZVXZZDOWIE-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |