C62H74BrN5Zn — CID 136983195
4-[15-bromo-10,20-bis(3,5-dihexylphenyl)-21,23-dihydroporphyrin-5-yl]aniline;zinc (PubChem CID 136983195) has the molecular formula C62H74BrN5Zn and a molecular weight of 1034.60 g/mol. Its IUPAC name is 4-[15-bromo-10,20-bis(3,5-dihexylphenyl)-21,23-dihydroporphyrin-5-yl]aniline;zinc.
| Compound Name | 4-[15-bromo-10,20-bis(3,5-dihexylphenyl)-21,23-dihydroporphyrin-5-yl]aniline;zinc |
|---|---|
| PubChem CID | 136983195 |
| Molecular Formula | C62H74BrN5Zn |
| Molecular Weight | 1034.60 g/mol |
| Exact Mass | 1031.44 |
| IUPAC Name | 4-[15-bromo-10,20-bis(3,5-dihexylphenyl)-21,23-dihydroporphyrin-5-yl]aniline;zinc |
| SMILES | CCCCCCc1cc(CCCCCC)cc(-c2c3nc(c(-c4ccc(N)cc4)c4ccc([nH]4)c(-c4cc(CCCCCC)cc(CCCCCC)c4)c4nc(c(Br)c5ccc2[nH]5)C=C4)C=C3)c1.[Zn] |
| InChI | InChI=1S/C62H74BrN5.Zn/c1-5-9-13-17-21-43-37-44(22-18-14-10-6-2)40-48(39-43)60-53-31-29-51(65-53)59(47-25-27-50(64)28-26-47)52-30-32-54(66-52)61(56-34-36-58(68-56)62(63)57-35-33-55(60)67-57)49-41-45(23-19-15-11-7-3)38-46(42-49)24-20-16-12-8-4;/h25-42,65,68H,5-24,64H2,1-4H3;/b59-51-,59-52-,60-53-,60-55-,61-54-,61-56-,62-57+,62-58+; |
| InChIKey | SXZLABBWJVSDIO-CAAZSTSXSA-N |
| XLogP | 18.49 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1034.60 |
| LogP ≤ 5 | 18.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|