C31H24F4N6O — CID 136983543
2-fluoro-4-[3-[5-(quinolin-8-ylmethyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-2-yl]-1H-indazol-6-yl]-5-(2,2,2-trifluoroethyl)phenol (PubChem CID 136983543) has the molecular formula C31H24F4N6O and a molecular weight of 572.57 g/mol. Its IUPAC name is 2-fluoro-4-[3-[5-(quinolin-8-ylmethyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-2-yl]-1H-indazol-6-yl]-5-(2,2,2-trifluoroethyl)phenol.
| Compound Name | 2-fluoro-4-[3-[5-(quinolin-8-ylmethyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-2-yl]-1H-indazol-6-yl]-5-(2,2,2-trifluoroethyl)phenol |
|---|---|
| PubChem CID | 136983543 |
| Molecular Formula | C31H24F4N6O |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | 2-fluoro-4-[3-[5-(quinolin-8-ylmethyl)-3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-2-yl]-1H-indazol-6-yl]-5-(2,2,2-trifluoroethyl)phenol |
| SMILES | Oc1cc(CC(F)(F)F)c(-c2ccc3c(-c4nc5c([nH]4)CN(Cc4cccc6cccnc46)CC5)n[nH]c3c2)cc1F |
| InChI | InChI=1S/C31H24F4N6O/c32-23-13-22(20(12-27(23)42)14-31(33,34)35)18-6-7-21-25(11-18)39-40-29(21)30-37-24-8-10-41(16-26(24)38-30)15-19-4-1-3-17-5-2-9-36-28(17)19/h1-7,9,11-13,42H,8,10,14-16H2,(H,37,38)(H,39,40) |
| InChIKey | IIAYCWSQSIGSMW-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 93.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |