C15H20FN3O — CID 136995908
5-ethyl-5-(2-fluorophenyl)-2-(2-methylpropylimino)imidazolidin-4-one (PubChem CID 136995908) has the molecular formula C15H20FN3O and a molecular weight of 277.34 g/mol. Its IUPAC name is 5-ethyl-5-(2-fluorophenyl)-2-(2-methylpropylimino)imidazolidin-4-one.
| Compound Name | 5-ethyl-5-(2-fluorophenyl)-2-(2-methylpropylimino)imidazolidin-4-one |
|---|---|
| PubChem CID | 136995908 |
| Molecular Formula | C15H20FN3O |
| Molecular Weight | 277.34 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 5-ethyl-5-(2-fluorophenyl)-2-(2-methylpropylimino)imidazolidin-4-one |
| SMILES | CCC1(c2ccccc2F)N/C(=N/CC(C)C)NC1=O |
| InChI | InChI=1S/C15H20FN3O/c1-4-15(11-7-5-6-8-12(11)16)13(20)18-14(19-15)17-9-10(2)3/h5-8,10H,4,9H2,1-3H3,(H2,17,18,19,20) |
| InChIKey | LSEQJXWWRPVYGO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.34 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|