C35H47N8O8P — CID 136997138
(2S)-2-[[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethyl-(3-methoxy-3-oxopropyl)amino]ethyl-[[(1S)-1-carboxy-2-phenylethyl]amino]phosphoryl]amino]-2-ethyl-3-phenylpentanoic acid (PubChem CID 136997138) has the molecular formula C35H47N8O8P and a molecular weight of 738.78 g/mol. Its IUPAC name is (2S)-2-[[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethyl-(3-methoxy-3-oxopropyl)amino]ethyl-[[(1S)-1-carboxy-2-phenylethyl]amino]phosphoryl]amino]-2-ethyl-3-phenylpentanoic acid.
| Compound Name | (2S)-2-[[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethyl-(3-methoxy-3-oxopropyl)amino]ethyl-[[(1S)-1-carboxy-2-phenylethyl]amino]phosphoryl]amino]-2-ethyl-3-phenylpentanoic acid |
|---|---|
| PubChem CID | 136997138 |
| Molecular Formula | C35H47N8O8P |
| Molecular Weight | 738.78 g/mol |
| Exact Mass | 738.33 |
| IUPAC Name | (2S)-2-[[2-[2-(2-amino-6-oxo-1H-purin-9-yl)ethyl-(3-methoxy-3-oxopropyl)amino]ethyl-[[(1S)-1-carboxy-2-phenylethyl]amino]phosphoryl]amino]-2-ethyl-3-phenylpentanoic acid |
| SMILES | CCC(c1ccccc1)[C@](CC)(NP(=O)(CCN(CCC(=O)OC)CCn1cnc2c(=O)[nH]c(N)nc21)N[C@@H](Cc1ccccc1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C35H47N8O8P/c1-4-26(25-14-10-7-11-15-25)35(5-2,33(48)49)41-52(50,40-27(32(46)47)22-24-12-8-6-9-13-24)21-20-42(17-16-28(44)51-3)18-19-43-23-37-29-30(43)38-34(36)39-31(29)45/h6-15,23,26-27H,4-5,16-22H2,1-3H3,(H,46,47)(H,48,49)(H2,40,41,50)(H3,36,38,39,45)/t26?,27-,35-,52?/m0/s1 |
| InChIKey | WWPHOWNBFASJKC-VHCZPXMESA-N |
| XLogP | 3.06 |
| TPSA | 234.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.78 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|