C12H9ClN2O2S — CID 137005031
5-chloro-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzaldehyde (PubChem CID 137005031) has the molecular formula C12H9ClN2O2S and a molecular weight of 280.74 g/mol. Its IUPAC name is 5-chloro-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzaldehyde.
| Compound Name | 5-chloro-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzaldehyde |
|---|---|
| PubChem CID | 137005031 |
| Molecular Formula | C12H9ClN2O2S |
| Molecular Weight | 280.74 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 5-chloro-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]benzaldehyde |
| SMILES | Cc1cc(=O)[nH]c(Sc2ccc(Cl)cc2C=O)n1 |
| InChI | InChI=1S/C12H9ClN2O2S/c1-7-4-11(17)15-12(14-7)18-10-3-2-9(13)5-8(10)6-16/h2-6H,1H3,(H,14,15,17) |
| InChIKey | YMEYUGALFLYMFR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.74 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|