About 5-(5-cyano-2,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid
5-(5-cyano-2,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid (PubChem CID 137011543) has the molecular formula C11H6N2O5
and a molecular weight of 246.18 g/mol. Its IUPAC name is 5-(5-cyano-2,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid.
Analyze 5-(5-cyano-2,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-cyano-2,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-(5-cyano-2,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid (CID 137011543) is 5-(5-cyano-2,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-(5-cyano-2,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-(5-cyano-2,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid is N#Cc1cc(-c2cc(C(=O)O)no2)c(O)cc1O.
What is the InChIKey of 5-(5-cyano-2,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid?
The InChIKey is PHMXSIPPUIPWSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2O5/c12-4-5-1-6(9(15)3-8(5)14)10-2-7(11(16)17)13-18-10/h1-3,14-15H,(H,16,17).
What are the key properties of 5-(5-cyano-2,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid?
5-(5-cyano-2,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid has a molecular weight of 246.18 g/mol, XLogP of 1.32, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-cyano-2,4-dihydroxyphenyl)-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 137011543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).