C11H12ClN3O — CID 137017167
2-(3-amino-1H-pyrazol-5-yl)-6-chloro-3,4-dimethylphenol (PubChem CID 137017167) has the molecular formula C11H12ClN3O and a molecular weight of 237.69 g/mol. Its IUPAC name is 2-(3-amino-1H-pyrazol-5-yl)-6-chloro-3,4-dimethylphenol.
| Compound Name | 2-(3-amino-1H-pyrazol-5-yl)-6-chloro-3,4-dimethylphenol |
|---|---|
| PubChem CID | 137017167 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 2-(3-amino-1H-pyrazol-5-yl)-6-chloro-3,4-dimethylphenol |
| SMILES | Cc1cc(Cl)c(O)c(-c2cc(N)n[nH]2)c1C |
| InChI | InChI=1S/C11H12ClN3O/c1-5-3-7(12)11(16)10(6(5)2)8-4-9(13)15-14-8/h3-4,16H,1-2H3,(H3,13,14,15) |
| InChIKey | XXPNKRWUPHFIBY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |