C24H38N4 — CID 137026430
N'-cyclohexyl-N-[[4-[[(3,6-dimethyl-3,4-dihydro-1H-pyridin-2-ylidene)amino]methyl]phenyl]methyl]propane-1,3-diamine (PubChem CID 137026430) has the molecular formula C24H38N4 and a molecular weight of 382.60 g/mol. Its IUPAC name is N'-cyclohexyl-N-[[4-[[(3,6-dimethyl-3,4-dihydro-1H-pyridin-2-ylidene)amino]methyl]phenyl]methyl]propane-1,3-diamine.
| Compound Name | N'-cyclohexyl-N-[[4-[[(3,6-dimethyl-3,4-dihydro-1H-pyridin-2-ylidene)amino]methyl]phenyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 137026430 |
| Molecular Formula | C24H38N4 |
| Molecular Weight | 382.60 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | N'-cyclohexyl-N-[[4-[[(3,6-dimethyl-3,4-dihydro-1H-pyridin-2-ylidene)amino]methyl]phenyl]methyl]propane-1,3-diamine |
| SMILES | CC1=CCC(C)/C(=N/Cc2ccc(CNCCCNC3CCCCC3)cc2)N1 |
| InChI | InChI=1S/C24H38N4/c1-19-9-10-20(2)28-24(19)27-18-22-13-11-21(12-14-22)17-25-15-6-16-26-23-7-4-3-5-8-23/h10-14,19,23,25-26H,3-9,15-18H2,1-2H3,(H,27,28) |
| InChIKey | ZQGLBYWVXRTZHR-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|