C26H23IN2O5S — CID 137027410
ethyl (5Z)-2-butanoylimino-5-[[4-[(2-cyanophenyl)methoxy]-3-iodophenyl]methylidene]-4-hydroxythiophene-3-carboxylate (PubChem CID 137027410) has the molecular formula C26H23IN2O5S and a molecular weight of 602.45 g/mol. Its IUPAC name is ethyl (5Z)-2-butanoylimino-5-[[4-[(2-cyanophenyl)methoxy]-3-iodophenyl]methylidene]-4-hydroxythiophene-3-carboxylate.
| Compound Name | ethyl (5Z)-2-butanoylimino-5-[[4-[(2-cyanophenyl)methoxy]-3-iodophenyl]methylidene]-4-hydroxythiophene-3-carboxylate |
|---|---|
| PubChem CID | 137027410 |
| Molecular Formula | C26H23IN2O5S |
| Molecular Weight | 602.45 g/mol |
| Exact Mass | 602.04 |
| IUPAC Name | ethyl (5Z)-2-butanoylimino-5-[[4-[(2-cyanophenyl)methoxy]-3-iodophenyl]methylidene]-4-hydroxythiophene-3-carboxylate |
| SMILES | CCCC(=O)/N=C1\S/C(=C\c2ccc(OCc3ccccc3C#N)c(I)c2)C(O)=C1C(=O)OCC |
| InChI | InChI=1S/C26H23IN2O5S/c1-3-7-22(30)29-25-23(26(32)33-4-2)24(31)21(35-25)13-16-10-11-20(19(27)12-16)34-15-18-9-6-5-8-17(18)14-28/h5-6,8-13,31H,3-4,7,15H2,1-2H3/b21-13-,29-25- |
| InChIKey | LSGXHDOJDFIGJM-OGKQLAPOSA-N |
| XLogP | 5.93 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|