C22H27N5O2 — CID 137053783
N-cyclohexyl-2-oxo-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazole-10-carboxamide (PubChem CID 137053783) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-cyclohexyl-2-oxo-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazole-10-carboxamide.
| Compound Name | N-cyclohexyl-2-oxo-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazole-10-carboxamide |
|---|---|
| PubChem CID | 137053783 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | N-cyclohexyl-2-oxo-4-piperidin-4-yl-1H-pyrimido[1,2-b]indazole-10-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1cccc2nn3c(C4CCNCC4)cc(=O)[nH]c3c12 |
| InChI | InChI=1S/C22H27N5O2/c28-19-13-18(14-9-11-23-12-10-14)27-21(25-19)20-16(7-4-8-17(20)26-27)22(29)24-15-5-2-1-3-6-15/h4,7-8,13-15,23H,1-3,5-6,9-12H2,(H,24,29)(H,25,28) |
| InChIKey | RDDPIVJMPUETIV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |