C21H23ClN4O4S — CID 137060490
N-[(E)-(7-chloro-5-hydroxy-2,3-dihydroinden-1-ylidene)amino]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide (PubChem CID 137060490) has the molecular formula C21H23ClN4O4S and a molecular weight of 462.96 g/mol. Its IUPAC name is N-[(E)-(7-chloro-5-hydroxy-2,3-dihydroinden-1-ylidene)amino]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-[(E)-(7-chloro-5-hydroxy-2,3-dihydroinden-1-ylidene)amino]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 137060490 |
| Molecular Formula | C21H23ClN4O4S |
| Molecular Weight | 462.96 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | N-[(E)-(7-chloro-5-hydroxy-2,3-dihydroinden-1-ylidene)amino]-3-(4-methylpiperazin-1-yl)sulfonylbenzamide |
| SMILES | CN1CCN(S(=O)(=O)c2cccc(C(=O)N/N=C3\CCc4cc(O)cc(Cl)c43)c2)CC1 |
| InChI | InChI=1S/C21H23ClN4O4S/c1-25-7-9-26(10-8-25)31(29,30)17-4-2-3-15(12-17)21(28)24-23-19-6-5-14-11-16(27)13-18(22)20(14)19/h2-4,11-13,27H,5-10H2,1H3,(H,24,28)/b23-19+ |
| InChIKey | VZKXHPUWMOKTCB-FCDQGJHFSA-N |
| XLogP | 2.06 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.96 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|