C20H20ClN3O5S — CID 137060471
N-[(E)-(4-chloro-7-hydroxy-2,3-dihydroinden-1-ylidene)amino]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 137060471) has the molecular formula C20H20ClN3O5S and a molecular weight of 449.92 g/mol. Its IUPAC name is N-[(E)-(4-chloro-7-hydroxy-2,3-dihydroinden-1-ylidene)amino]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[(E)-(4-chloro-7-hydroxy-2,3-dihydroinden-1-ylidene)amino]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 137060471 |
| Molecular Formula | C20H20ClN3O5S |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | N-[(E)-(4-chloro-7-hydroxy-2,3-dihydroinden-1-ylidene)amino]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | O=C(N/N=C1\CCc2c(Cl)ccc(O)c21)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H20ClN3O5S/c21-16-5-7-18(25)19-15(16)4-6-17(19)22-23-20(26)13-2-1-3-14(12-13)30(27,28)24-8-10-29-11-9-24/h1-3,5,7,12,25H,4,6,8-11H2,(H,23,26)/b22-17+ |
| InChIKey | OWZNLIDYKYZVFB-OQKWZONESA-N |
| XLogP | 2.15 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|