C23H20BrN3O — CID 137070337
2-(4-bromo-2,3-dimethylphenyl)-5-methyl-4-(naphthalen-1-yliminomethyl)-1H-pyrazol-3-one (PubChem CID 137070337) has the molecular formula C23H20BrN3O and a molecular weight of 434.34 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dimethylphenyl)-5-methyl-4-(naphthalen-1-yliminomethyl)-1H-pyrazol-3-one.
| Compound Name | 2-(4-bromo-2,3-dimethylphenyl)-5-methyl-4-(naphthalen-1-yliminomethyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137070337 |
| Molecular Formula | C23H20BrN3O |
| Molecular Weight | 434.34 g/mol |
| Exact Mass | 433.08 |
| IUPAC Name | 2-(4-bromo-2,3-dimethylphenyl)-5-methyl-4-(naphthalen-1-yliminomethyl)-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccc(Br)c(C)c2C)c(=O)c1/C=N/c1cccc2ccccc12 |
| InChI | InChI=1S/C23H20BrN3O/c1-14-15(2)22(12-11-20(14)24)27-23(28)19(16(3)26-27)13-25-21-10-6-8-17-7-4-5-9-18(17)21/h4-13,26H,1-3H3/b25-13+ |
| InChIKey | DEZNWTHQYNNYPG-DHRITJCHSA-N |
| XLogP | 5.76 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.34 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|