C16H20BrN3O — CID 137073294
2-(4-bromo-2,3-dimethylphenyl)-5-methyl-4-(propan-2-yliminomethyl)-1H-pyrazol-3-one (PubChem CID 137073294) has the molecular formula C16H20BrN3O and a molecular weight of 350.26 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dimethylphenyl)-5-methyl-4-(propan-2-yliminomethyl)-1H-pyrazol-3-one.
| Compound Name | 2-(4-bromo-2,3-dimethylphenyl)-5-methyl-4-(propan-2-yliminomethyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137073294 |
| Molecular Formula | C16H20BrN3O |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-(4-bromo-2,3-dimethylphenyl)-5-methyl-4-(propan-2-yliminomethyl)-1H-pyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccc(Br)c(C)c2C)c(=O)c1/C=N/C(C)C |
| InChI | InChI=1S/C16H20BrN3O/c1-9(2)18-8-13-12(5)19-20(16(13)21)15-7-6-14(17)10(3)11(15)4/h6-9,19H,1-5H3/b18-8+ |
| InChIKey | BOHWXJRIXTXXLM-QGMBQPNBSA-N |
| XLogP | 3.68 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|