C21H21BrN4O3 — CID 137070085
2-(4-bromo-2,3-dimethylphenyl)-4-[(3,4-dimethyl-5-nitrophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one (PubChem CID 137070085) has the molecular formula C21H21BrN4O3 and a molecular weight of 457.33 g/mol. Its IUPAC name is 2-(4-bromo-2,3-dimethylphenyl)-4-[(3,4-dimethyl-5-nitrophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one.
| Compound Name | 2-(4-bromo-2,3-dimethylphenyl)-4-[(3,4-dimethyl-5-nitrophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137070085 |
| Molecular Formula | C21H21BrN4O3 |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 456.08 |
| IUPAC Name | 2-(4-bromo-2,3-dimethylphenyl)-4-[(3,4-dimethyl-5-nitrophenyl)iminomethyl]-5-methyl-1H-pyrazol-3-one |
| SMILES | Cc1cc(/N=C/c2c(C)[nH]n(-c3ccc(Br)c(C)c3C)c2=O)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C21H21BrN4O3/c1-11-8-16(9-20(12(11)2)26(28)29)23-10-17-15(5)24-25(21(17)27)19-7-6-18(22)13(3)14(19)4/h6-10,24H,1-5H3/b23-10+ |
| InChIKey | NJUWVLXTRAJHJX-AUEPDCJTSA-N |
| XLogP | 5.13 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|