C20H17Cl2N3O3 — CID 137071645
ethyl 4-chloro-2-(4-chloroanilino)-5-[(E)-(phenylhydrazinylidene)methyl]furan-3-carboxylate (PubChem CID 137071645) has the molecular formula C20H17Cl2N3O3 and a molecular weight of 418.28 g/mol. Its IUPAC name is ethyl 4-chloro-2-(4-chloroanilino)-5-[(E)-(phenylhydrazinylidene)methyl]furan-3-carboxylate.
| Compound Name | ethyl 4-chloro-2-(4-chloroanilino)-5-[(E)-(phenylhydrazinylidene)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 137071645 |
| Molecular Formula | C20H17Cl2N3O3 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | ethyl 4-chloro-2-(4-chloroanilino)-5-[(E)-(phenylhydrazinylidene)methyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2ccc(Cl)cc2)oc(/C=N/Nc2ccccc2)c1Cl |
| InChI | InChI=1S/C20H17Cl2N3O3/c1-2-27-20(26)17-18(22)16(12-23-25-15-6-4-3-5-7-15)28-19(17)24-14-10-8-13(21)9-11-14/h3-12,24-25H,2H2,1H3/b23-12+ |
| InChIKey | GLTKEEPCTSMGHE-FSJBWODESA-N |
| XLogP | 5.95 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|