C21H16Cl2N4O6 — CID 137071810
ethyl 4-chloro-2-(3-chloroanilino)-5-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]furan-3-carboxylate (PubChem CID 137071810) has the molecular formula C21H16Cl2N4O6 and a molecular weight of 491.29 g/mol. Its IUPAC name is ethyl 4-chloro-2-(3-chloroanilino)-5-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]furan-3-carboxylate.
| Compound Name | ethyl 4-chloro-2-(3-chloroanilino)-5-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 137071810 |
| Molecular Formula | C21H16Cl2N4O6 |
| Molecular Weight | 491.29 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | ethyl 4-chloro-2-(3-chloroanilino)-5-[(Z)-[(3-nitrobenzoyl)hydrazinylidene]methyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2cccc(Cl)c2)oc(/C=N\NC(=O)c2cccc([N+](=O)[O-])c2)c1Cl |
| InChI | InChI=1S/C21H16Cl2N4O6/c1-2-32-21(29)17-18(23)16(33-20(17)25-14-7-4-6-13(22)10-14)11-24-26-19(28)12-5-3-8-15(9-12)27(30)31/h3-11,25H,2H2,1H3,(H,26,28)/b24-11- |
| InChIKey | KLZUNVZWFBCYPY-MYKKPKGFSA-N |
| XLogP | 5.18 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.29 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|