C25H19Cl2N3O4 — CID 137155677
ethyl 4-chloro-2-(4-chloroanilino)-5-[(Z)-(naphthalene-2-carbonylhydrazinylidene)methyl]furan-3-carboxylate (PubChem CID 137155677) has the molecular formula C25H19Cl2N3O4 and a molecular weight of 496.35 g/mol. Its IUPAC name is ethyl 4-chloro-2-(4-chloroanilino)-5-[(Z)-(naphthalene-2-carbonylhydrazinylidene)methyl]furan-3-carboxylate.
| Compound Name | ethyl 4-chloro-2-(4-chloroanilino)-5-[(Z)-(naphthalene-2-carbonylhydrazinylidene)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 137155677 |
| Molecular Formula | C25H19Cl2N3O4 |
| Molecular Weight | 496.35 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | ethyl 4-chloro-2-(4-chloroanilino)-5-[(Z)-(naphthalene-2-carbonylhydrazinylidene)methyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2ccc(Cl)cc2)oc(/C=N\NC(=O)c2ccc3ccccc3c2)c1Cl |
| InChI | InChI=1S/C25H19Cl2N3O4/c1-2-33-25(32)21-22(27)20(34-24(21)29-19-11-9-18(26)10-12-19)14-28-30-23(31)17-8-7-15-5-3-4-6-16(15)13-17/h3-14,29H,2H2,1H3,(H,30,31)/b28-14- |
| InChIKey | KWEIDBDLCFLWCM-MUXKCCDJSA-N |
| XLogP | 6.42 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.35 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|