C23H22Cl2N4O5 — CID 137071742
ethyl 4-chloro-2-(3-chloroanilino)-5-[(Z)-[(4-ethoxyphenyl)carbamoylhydrazinylidene]methyl]furan-3-carboxylate (PubChem CID 137071742) has the molecular formula C23H22Cl2N4O5 and a molecular weight of 505.36 g/mol. Its IUPAC name is ethyl 4-chloro-2-(3-chloroanilino)-5-[(Z)-[(4-ethoxyphenyl)carbamoylhydrazinylidene]methyl]furan-3-carboxylate.
| Compound Name | ethyl 4-chloro-2-(3-chloroanilino)-5-[(Z)-[(4-ethoxyphenyl)carbamoylhydrazinylidene]methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 137071742 |
| Molecular Formula | C23H22Cl2N4O5 |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | ethyl 4-chloro-2-(3-chloroanilino)-5-[(Z)-[(4-ethoxyphenyl)carbamoylhydrazinylidene]methyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2cccc(Cl)c2)oc(/C=N\NC(=O)Nc2ccc(OCC)cc2)c1Cl |
| InChI | InChI=1S/C23H22Cl2N4O5/c1-3-32-17-10-8-15(9-11-17)28-23(31)29-26-13-18-20(25)19(22(30)33-4-2)21(34-18)27-16-7-5-6-14(24)12-16/h5-13,27H,3-4H2,1-2H3,(H2,28,29,31)/b26-13- |
| InChIKey | SGOCYSBEIFAGCC-ZMFRSBBQSA-N |
| XLogP | 6.06 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|