C21H18Cl2N4O4 — CID 137071968
ethyl 4-chloro-2-(4-chloroanilino)-5-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]furan-3-carboxylate (PubChem CID 137071968) has the molecular formula C21H18Cl2N4O4 and a molecular weight of 461.31 g/mol. Its IUPAC name is ethyl 4-chloro-2-(4-chloroanilino)-5-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]furan-3-carboxylate.
| Compound Name | ethyl 4-chloro-2-(4-chloroanilino)-5-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 137071968 |
| Molecular Formula | C21H18Cl2N4O4 |
| Molecular Weight | 461.31 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | ethyl 4-chloro-2-(4-chloroanilino)-5-[(Z)-(phenylcarbamoylhydrazinylidene)methyl]furan-3-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2ccc(Cl)cc2)oc(/C=N\NC(=O)Nc2ccccc2)c1Cl |
| InChI | InChI=1S/C21H18Cl2N4O4/c1-2-30-20(28)17-18(23)16(31-19(17)25-15-10-8-13(22)9-11-15)12-24-27-21(29)26-14-6-4-3-5-7-14/h3-12,25H,2H2,1H3,(H2,26,27,29)/b24-12- |
| InChIKey | RKRPPVGTSZEWCV-MSXFZWOLSA-N |
| XLogP | 5.66 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.31 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|