C56H37N7O2 — CID 137081557
4-methyl-7-[1-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]triazol-4-yl]chromen-2-one (PubChem CID 137081557) has the molecular formula C56H37N7O2 and a molecular weight of 839.96 g/mol. Its IUPAC name is 4-methyl-7-[1-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]triazol-4-yl]chromen-2-one.
| Compound Name | 4-methyl-7-[1-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]triazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 137081557 |
| Molecular Formula | C56H37N7O2 |
| Molecular Weight | 839.96 g/mol |
| Exact Mass | 839.30 |
| IUPAC Name | 4-methyl-7-[1-[4-(10,15,20-triphenyl-21,23-dihydroporphyrin-5-yl)phenyl]triazol-4-yl]chromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(-c3cn(-c4ccc(-c5c6nc(c(-c7ccccc7)c7ccc([nH]7)c(-c7ccccc7)c7nc(c(-c8ccccc8)c8ccc5[nH]8)C=C7)C=C6)cc4)nn3)ccc12 |
| InChI | InChI=1S/C56H37N7O2/c1-34-31-52(64)65-51-32-39(19-22-41(34)51)50-33-63(62-61-50)40-20-17-38(18-21-40)56-48-29-27-46(59-48)54(36-13-7-3-8-14-36)44-25-23-42(57-44)53(35-11-5-2-6-12-35)43-24-26-45(58-43)55(37-15-9-4-10-16-37)47-28-30-49(56)60-47/h2-33,57,60H,1H3/b53-42-,53-43-,54-44-,54-46-,55-45-,55-47-,56-48-,56-49- |
| InChIKey | PJIDZJPFRIZFJN-NIZKSVDQSA-N |
| XLogP | 12.99 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.96 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|