C14H10N4 — CID 137084077
3,5,11,13-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1,4,6,8,10,13,15,17-octaene (PubChem CID 137084077) has the molecular formula C14H10N4 and a molecular weight of 234.26 g/mol. Its IUPAC name is 3,5,11,13-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1,4,6,8,10,13,15,17-octaene.
| Compound Name | 3,5,11,13-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1,4,6,8,10,13,15,17-octaene |
|---|---|
| PubChem CID | 137084077 |
| Molecular Formula | C14H10N4 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 3,5,11,13-tetrazatetracyclo[12.4.0.02,6.07,12]octadeca-1,4,6,8,10,13,15,17-octaene |
| SMILES | C1=CC2=c3nc[nH]c3=c3ccccc3=NC2N=C1 |
| InChI | InChI=1S/C14H10N4/c1-2-6-11-9(4-1)12-13(17-8-16-12)10-5-3-7-15-14(10)18-11/h1-8,14H,(H,16,17) |
| InChIKey | DUZHSQXBIQEKSZ-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |