C10H7N3 — CID 172758593
2,10,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,4,6,8,11-hexaene (PubChem CID 172758593) has the molecular formula C10H7N3 and a molecular weight of 169.19 g/mol. Its IUPAC name is 2,10,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,4,6,8,11-hexaene.
| Compound Name | 2,10,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,4,6,8,11-hexaene |
|---|---|
| PubChem CID | 172758593 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | 2,10,12-triazatricyclo[7.4.0.03,7]trideca-1(13),2,4,6,8,11-hexaene |
| SMILES | c1cc2cc3[nH]cncc3nc2c1 |
| InChI | InChI=1S/C10H7N3/c1-2-7-4-9-10(5-11-6-12-9)13-8(7)3-1/h1-6H,(H,11,12) |
| InChIKey | QLZQOZUNAJCYBX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |