C16H18F2N2O2 — CID 137084113
4-(2,3-difluoro-4-hexoxyphenyl)-1H-pyrimidin-6-one (PubChem CID 137084113) has the molecular formula C16H18F2N2O2 and a molecular weight of 308.33 g/mol. Its IUPAC name is 4-(2,3-difluoro-4-hexoxyphenyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(2,3-difluoro-4-hexoxyphenyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137084113 |
| Molecular Formula | C16H18F2N2O2 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 4-(2,3-difluoro-4-hexoxyphenyl)-1H-pyrimidin-6-one |
| SMILES | CCCCCCOc1ccc(-c2cc(=O)[nH]cn2)c(F)c1F |
| InChI | InChI=1S/C16H18F2N2O2/c1-2-3-4-5-8-22-13-7-6-11(15(17)16(13)18)12-9-14(21)20-10-19-12/h6-7,9-10H,2-5,8H2,1H3,(H,19,20,21) |
| InChIKey | JTADEQMKFAYCFH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|