C21H19N7O2 — CID 137084248
4-[(4-ethyl-5-methyl-1-pyrimidin-2-ylimidazol-2-yl)diazenyl]-3-hydroxynaphthalene-2-carboxamide (PubChem CID 137084248) has the molecular formula C21H19N7O2 and a molecular weight of 401.43 g/mol. Its IUPAC name is 4-[(4-ethyl-5-methyl-1-pyrimidin-2-ylimidazol-2-yl)diazenyl]-3-hydroxynaphthalene-2-carboxamide.
| Compound Name | 4-[(4-ethyl-5-methyl-1-pyrimidin-2-ylimidazol-2-yl)diazenyl]-3-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 137084248 |
| Molecular Formula | C21H19N7O2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | 4-[(4-ethyl-5-methyl-1-pyrimidin-2-ylimidazol-2-yl)diazenyl]-3-hydroxynaphthalene-2-carboxamide |
| SMILES | CCc1nc(/N=N/c2c(O)c(C(N)=O)cc3ccccc23)n(-c2ncccn2)c1C |
| InChI | InChI=1S/C21H19N7O2/c1-3-16-12(2)28(20-23-9-6-10-24-20)21(25-16)27-26-17-14-8-5-4-7-13(14)11-15(18(17)29)19(22)30/h4-11,29H,3H2,1-2H3,(H2,22,30)/b27-26+ |
| InChIKey | NXNKCJNPDLUMOY-CYYJNZCTSA-N |
| XLogP | 3.91 |
| TPSA | 131.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|