C26H26N2O5 — CID 137084373
N-[[2-(1,3-benzodioxol-5-yl)-1-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)ethylidene]amino]benzamide (PubChem CID 137084373) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is N-[[2-(1,3-benzodioxol-5-yl)-1-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)ethylidene]amino]benzamide.
| Compound Name | N-[[2-(1,3-benzodioxol-5-yl)-1-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)ethylidene]amino]benzamide |
|---|---|
| PubChem CID | 137084373 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | N-[[2-(1,3-benzodioxol-5-yl)-1-(2-hydroxy-4-methoxy-5-propan-2-ylphenyl)ethylidene]amino]benzamide |
| SMILES | COc1cc(O)c(C(Cc2ccc3c(c2)OCO3)=NNC(=O)c2ccccc2)cc1C(C)C |
| InChI | InChI=1S/C26H26N2O5/c1-16(2)19-13-20(22(29)14-24(19)31-3)21(27-28-26(30)18-7-5-4-6-8-18)11-17-9-10-23-25(12-17)33-15-32-23/h4-10,12-14,16,29H,11,15H2,1-3H3,(H,28,30) |
| InChIKey | OXWFWYQAWSSCNH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|