C18H14FN5O — CID 137097693
N'-[3-(2-cyclopropylethynyl)-4-fluorophenyl]-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide (PubChem CID 137097693) has the molecular formula C18H14FN5O and a molecular weight of 335.34 g/mol. Its IUPAC name is N'-[3-(2-cyclopropylethynyl)-4-fluorophenyl]-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide.
| Compound Name | N'-[3-(2-cyclopropylethynyl)-4-fluorophenyl]-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 137097693 |
| Molecular Formula | C18H14FN5O |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | N'-[3-(2-cyclopropylethynyl)-4-fluorophenyl]-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(C#CC2CC2)c1)c1ccnc2nc[nH]c12 |
| InChI | InChI=1S/C18H14FN5O/c19-15-6-5-13(9-12(15)4-3-11-1-2-11)23-17(24-25)14-7-8-20-18-16(14)21-10-22-18/h5-11,25H,1-2H2,(H,23,24)(H,20,21,22) |
| InChIKey | PEXROSHIJYOFMH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|