C19H14FN5O — CID 137097629
N'-(4-fluoro-3-phenylphenyl)-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide (PubChem CID 137097629) has the molecular formula C19H14FN5O and a molecular weight of 347.35 g/mol. Its IUPAC name is N'-(4-fluoro-3-phenylphenyl)-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide.
| Compound Name | N'-(4-fluoro-3-phenylphenyl)-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 137097629 |
| Molecular Formula | C19H14FN5O |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N'-(4-fluoro-3-phenylphenyl)-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(-c2ccccc2)c1)c1ccnc2nc[nH]c12 |
| InChI | InChI=1S/C19H14FN5O/c20-16-7-6-13(10-15(16)12-4-2-1-3-5-12)24-18(25-26)14-8-9-21-19-17(14)22-11-23-19/h1-11,26H,(H,24,25)(H,21,22,23) |
| InChIKey | HFAANUDYLRHYSW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|