C7H3Cl2FN2O2 — CID 137098282
4,6-dichloro-7-fluoro-2H-pyrrolo[3,4-c]pyridine-1,3-diol (PubChem CID 137098282) has the molecular formula C7H3Cl2FN2O2 and a molecular weight of 237.02 g/mol. Its IUPAC name is 4,6-dichloro-7-fluoro-2H-pyrrolo[3,4-c]pyridine-1,3-diol.
| Compound Name | 4,6-dichloro-7-fluoro-2H-pyrrolo[3,4-c]pyridine-1,3-diol |
|---|---|
| PubChem CID | 137098282 |
| Molecular Formula | C7H3Cl2FN2O2 |
| Molecular Weight | 237.02 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 4,6-dichloro-7-fluoro-2H-pyrrolo[3,4-c]pyridine-1,3-diol |
| SMILES | Oc1[nH]c(O)c2c(F)c(Cl)nc(Cl)c12 |
| InChI | InChI=1S/C7H3Cl2FN2O2/c8-4-2-1(3(10)5(9)11-4)6(13)12-7(2)14/h12-14H |
| InChIKey | FGFBPDFCWCPWSD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.02 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|