C19H15N3O3 — CID 137100646
7-[2-(5-hydroxy-1H-indol-3-yl)ethylideneamino]quinoline-5,8-diol (PubChem CID 137100646) has the molecular formula C19H15N3O3 and a molecular weight of 333.35 g/mol. Its IUPAC name is 7-[2-(5-hydroxy-1H-indol-3-yl)ethylideneamino]quinoline-5,8-diol.
| Compound Name | 7-[2-(5-hydroxy-1H-indol-3-yl)ethylideneamino]quinoline-5,8-diol |
|---|---|
| PubChem CID | 137100646 |
| Molecular Formula | C19H15N3O3 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 7-[2-(5-hydroxy-1H-indol-3-yl)ethylideneamino]quinoline-5,8-diol |
| SMILES | Oc1ccc2[nH]cc(C/C=N/c3cc(O)c4cccnc4c3O)c2c1 |
| InChI | InChI=1S/C19H15N3O3/c23-12-3-4-15-14(8-12)11(10-22-15)5-7-20-16-9-17(24)13-2-1-6-21-18(13)19(16)25/h1-4,6-10,22-25H,5H2/b20-7+ |
| InChIKey | GOBNINQLLQPGOU-IFRROFPPSA-N |
| XLogP | 3.78 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|