C15H25N6O12P3 — CID 137103615
[[5-(2-amino-6-oxo-1H-purin-9-yl)-3-(2-iminoethyl)oxolan-2-yl]methoxy-methoxyphosphoryl] [hydroxy(methoxy)phosphoryl] methyl phosphate (PubChem CID 137103615) has the molecular formula C15H25N6O12P3 and a molecular weight of 574.32 g/mol. Its IUPAC name is [[5-(2-amino-6-oxo-1H-purin-9-yl)-3-(2-iminoethyl)oxolan-2-yl]methoxy-methoxyphosphoryl] [hydroxy(methoxy)phosphoryl] methyl phosphate.
| Compound Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-3-(2-iminoethyl)oxolan-2-yl]methoxy-methoxyphosphoryl] [hydroxy(methoxy)phosphoryl] methyl phosphate |
|---|---|
| PubChem CID | 137103615 |
| Molecular Formula | C15H25N6O12P3 |
| Molecular Weight | 574.32 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | [[5-(2-amino-6-oxo-1H-purin-9-yl)-3-(2-iminoethyl)oxolan-2-yl]methoxy-methoxyphosphoryl] [hydroxy(methoxy)phosphoryl] methyl phosphate |
| SMILES | [H]/N=C/CC1CC(n2cnc3c(=O)[nH]c(N)nc32)OC1COP(=O)(OC)OP(=O)(OC)OP(=O)(O)OC |
| InChI | InChI=1S/C15H25N6O12P3/c1-27-34(23,24)32-36(26,29-3)33-35(25,28-2)30-7-10-9(4-5-16)6-11(31-10)21-8-18-12-13(21)19-15(17)20-14(12)22/h5,8-11,16H,4,6-7H2,1-3H3,(H,23,24)(H3,17,19,20,22)/b16-5+ |
| InChIKey | ZUFCFUOUMDFPEX-FZSIALSZSA-N |
| XLogP | 1.95 |
| TPSA | 249.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|