C24H18FNO3S — CID 137130111
(4-fluorophenyl) 2-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]-1,3-benzothiazole-6-carboxylate (PubChem CID 137130111) has the molecular formula C24H18FNO3S and a molecular weight of 419.48 g/mol. Its IUPAC name is (4-fluorophenyl) 2-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]-1,3-benzothiazole-6-carboxylate.
| Compound Name | (4-fluorophenyl) 2-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 137130111 |
| Molecular Formula | C24H18FNO3S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | (4-fluorophenyl) 2-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]-1,3-benzothiazole-6-carboxylate |
| SMILES | Cc1cc(C=Cc2nc3ccc(C(=O)Oc4ccc(F)cc4)cc3s2)cc(C)c1O |
| InChI | InChI=1S/C24H18FNO3S/c1-14-11-16(12-15(2)23(14)27)3-10-22-26-20-9-4-17(13-21(20)30-22)24(28)29-19-7-5-18(25)6-8-19/h3-13,27H,1-2H3 |
| InChIKey | AJMZUCYPBXNQTM-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|