C21H18N2O3 — CID 77482397
pyrimidin-5-yl 3-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]benzoate (PubChem CID 77482397) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is pyrimidin-5-yl 3-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]benzoate.
| Compound Name | pyrimidin-5-yl 3-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]benzoate |
|---|---|
| PubChem CID | 77482397 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | pyrimidin-5-yl 3-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]benzoate |
| SMILES | Cc1cc(C=Cc2cccc(C(=O)Oc3cncnc3)c2)cc(C)c1O |
| InChI | InChI=1S/C21H18N2O3/c1-14-8-17(9-15(2)20(14)24)7-6-16-4-3-5-18(10-16)21(25)26-19-11-22-13-23-12-19/h3-13,24H,1-2H3 |
| InChIKey | UHEYLFOHXLHCMZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|