C23H21NO5 — CID 153034618
N-hydroxy-2-[3-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]benzoyl]oxybenzeneamine oxide (PubChem CID 153034618) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is N-hydroxy-2-[3-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]benzoyl]oxybenzeneamine oxide.
| Compound Name | N-hydroxy-2-[3-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]benzoyl]oxybenzeneamine oxide |
|---|---|
| PubChem CID | 153034618 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-hydroxy-2-[3-[2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]benzoyl]oxybenzeneamine oxide |
| SMILES | Cc1cc(C=Cc2cccc(C(=O)Oc3ccccc3[NH+]([O-])O)c2)cc(C)c1O |
| InChI | InChI=1S/C23H21NO5/c1-15-12-18(13-16(2)22(15)25)11-10-17-6-5-7-19(14-17)23(26)29-21-9-4-3-8-20(21)24(27)28/h3-14,24-25,27H,1-2H3 |
| InChIKey | VEMJFBRCBBJBEA-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 94.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|