C25H24N2O3S — CID 137131177
ethyl 5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-(4-methylanilino)thiophene-3-carboxylate (PubChem CID 137131177) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is ethyl 5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-(4-methylanilino)thiophene-3-carboxylate.
| Compound Name | ethyl 5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-(4-methylanilino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 137131177 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | ethyl 5-[(7-ethylindol-3-ylidene)methyl]-4-hydroxy-2-(4-methylanilino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(Nc2ccc(C)cc2)sc(C=C2C=Nc3c(CC)cccc32)c1O |
| InChI | InChI=1S/C25H24N2O3S/c1-4-16-7-6-8-19-17(14-26-22(16)19)13-20-23(28)21(25(29)30-5-2)24(31-20)27-18-11-9-15(3)10-12-18/h6-14,27-28H,4-5H2,1-3H3 |
| InChIKey | YKBQLVAHWKBKRQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|