C24H27BrN4O7 — CID 137139020
methyl (4S)-4-[4-[(2R)-2-[(2Z)-2-[(3-bromo-4-hydroxyphenyl)methylidene]hydrazinyl]-2-hydroxyethoxy]-3-ethoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137139020) has the molecular formula C24H27BrN4O7 and a molecular weight of 563.41 g/mol. Its IUPAC name is methyl (4S)-4-[4-[(2R)-2-[(2Z)-2-[(3-bromo-4-hydroxyphenyl)methylidene]hydrazinyl]-2-hydroxyethoxy]-3-ethoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4S)-4-[4-[(2R)-2-[(2Z)-2-[(3-bromo-4-hydroxyphenyl)methylidene]hydrazinyl]-2-hydroxyethoxy]-3-ethoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137139020 |
| Molecular Formula | C24H27BrN4O7 |
| Molecular Weight | 563.41 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | methyl (4S)-4-[4-[(2R)-2-[(2Z)-2-[(3-bromo-4-hydroxyphenyl)methylidene]hydrazinyl]-2-hydroxyethoxy]-3-ethoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOc1cc([C@@H]2NC(=O)NC(C)=C2C(=O)OC)ccc1OC[C@@H](O)N/N=C\c1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C24H27BrN4O7/c1-4-35-19-10-15(22-21(23(32)34-3)13(2)27-24(33)28-22)6-8-18(19)36-12-20(31)29-26-11-14-5-7-17(30)16(25)9-14/h5-11,20,22,29-31H,4,12H2,1-3H3,(H2,27,28,33)/b26-11-/t20-,22+/m1/s1 |
| InChIKey | LLGPXQAJBQTXOB-DBFADYJMSA-N |
| XLogP | 2.68 |
| TPSA | 150.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.41 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|