C24H28N4O7 — CID 137079722
methyl (4S)-4-[3-ethoxy-4-[(2S)-2-hydroxy-2-[(2Z)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]ethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137079722) has the molecular formula C24H28N4O7 and a molecular weight of 484.51 g/mol. Its IUPAC name is methyl (4S)-4-[3-ethoxy-4-[(2S)-2-hydroxy-2-[(2Z)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]ethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4S)-4-[3-ethoxy-4-[(2S)-2-hydroxy-2-[(2Z)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]ethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137079722 |
| Molecular Formula | C24H28N4O7 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | methyl (4S)-4-[3-ethoxy-4-[(2S)-2-hydroxy-2-[(2Z)-2-[(2-hydroxyphenyl)methylidene]hydrazinyl]ethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOc1cc([C@@H]2NC(=O)NC(C)=C2C(=O)OC)ccc1OC[C@H](O)N/N=C\c1ccccc1O |
| InChI | InChI=1S/C24H28N4O7/c1-4-34-19-11-15(22-21(23(31)33-3)14(2)26-24(32)27-22)9-10-18(19)35-13-20(30)28-25-12-16-7-5-6-8-17(16)29/h5-12,20,22,28-30H,4,13H2,1-3H3,(H2,26,27,32)/b25-12-/t20-,22-/m0/s1 |
| InChIKey | SZHZSYMBUKCQCK-RAWPNPRJSA-N |
| XLogP | 1.91 |
| TPSA | 150.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|