C24H26N6O11 — CID 137065521
methyl (4R)-4-[3-ethoxy-4-[(2S)-2-hydroxy-2-[(2Z)-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]ethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137065521) has the molecular formula C24H26N6O11 and a molecular weight of 574.50 g/mol. Its IUPAC name is methyl (4R)-4-[3-ethoxy-4-[(2S)-2-hydroxy-2-[(2Z)-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]ethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4R)-4-[3-ethoxy-4-[(2S)-2-hydroxy-2-[(2Z)-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]ethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137065521 |
| Molecular Formula | C24H26N6O11 |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | methyl (4R)-4-[3-ethoxy-4-[(2S)-2-hydroxy-2-[(2Z)-2-[(2-hydroxy-3,5-dinitrophenyl)methylidene]hydrazinyl]ethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOc1cc([C@H]2NC(=O)NC(C)=C2C(=O)OC)ccc1OC[C@H](O)N/N=C\c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C24H26N6O11/c1-4-40-18-8-13(21-20(23(33)39-3)12(2)26-24(34)27-21)5-6-17(18)41-11-19(31)28-25-10-14-7-15(29(35)36)9-16(22(14)32)30(37)38/h5-10,19,21,28,31-32H,4,11H2,1-3H3,(H2,26,27,34)/b25-10-/t19-,21+/m0/s1 |
| InChIKey | ANZCRSFZFGWYBL-SGOVLUMTSA-N |
| XLogP | 1.73 |
| TPSA | 237.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|