C24H25N5O8 — CID 21211737
ethyl 4-[3-methoxy-4-[2-[2-[(4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 21211737) has the molecular formula C24H25N5O8 and a molecular weight of 511.49 g/mol. Its IUPAC name is ethyl 4-[3-methoxy-4-[2-[2-[(4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[3-methoxy-4-[2-[2-[(4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 21211737 |
| Molecular Formula | C24H25N5O8 |
| Molecular Weight | 511.49 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | ethyl 4-[3-methoxy-4-[2-[2-[(4-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=O)NC1c1ccc(OCC(=O)NN=Cc2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C24H25N5O8/c1-4-36-23(31)21-14(2)26-24(32)27-22(21)16-7-10-18(19(11-16)35-3)37-13-20(30)28-25-12-15-5-8-17(9-6-15)29(33)34/h5-12,22H,4,13H2,1-3H3,(H,28,30)(H2,26,27,32) |
| InChIKey | YVEFNWRHRRKTFY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 170.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|