C28H26ClN5O9 — CID 124553122
ethyl (4S)-4-[4-[2-[(2Z)-2-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 124553122) has the molecular formula C28H26ClN5O9 and a molecular weight of 612.00 g/mol. Its IUPAC name is ethyl (4S)-4-[4-[2-[(2Z)-2-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-4-[4-[2-[(2Z)-2-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 124553122 |
| Molecular Formula | C28H26ClN5O9 |
| Molecular Weight | 612.00 g/mol |
| Exact Mass | 611.14 |
| IUPAC Name | ethyl (4S)-4-[4-[2-[(2Z)-2-[[5-(4-chloro-3-nitrophenyl)furan-2-yl]methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=O)N[C@H]1c1ccc(OCC(=O)N/N=C\c2ccc(-c3ccc(Cl)c([N+](=O)[O-])c3)o2)c(OC)c1 |
| InChI | InChI=1S/C28H26ClN5O9/c1-4-41-27(36)25-15(2)31-28(37)32-26(25)17-6-9-22(23(12-17)40-3)42-14-24(35)33-30-13-18-7-10-21(43-18)16-5-8-19(29)20(11-16)34(38)39/h5-13,26H,4,14H2,1-3H3,(H,33,35)(H2,31,32,37)/b30-13-/t26-/m0/s1 |
| InChIKey | BHSVCTHPAQHCBG-NPELBABXSA-N |
| XLogP | 4.24 |
| TPSA | 183.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.00 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|