C23H22Cl2N4O7 — CID 137037197
methyl (4S)-4-[4-[2-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137037197) has the molecular formula C23H22Cl2N4O7 and a molecular weight of 537.36 g/mol. Its IUPAC name is methyl (4S)-4-[4-[2-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl (4S)-4-[4-[2-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137037197 |
| Molecular Formula | C23H22Cl2N4O7 |
| Molecular Weight | 537.36 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | methyl (4S)-4-[4-[2-[(2Z)-2-[(3,5-dichloro-2-hydroxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)C1=C(C)NC(=O)N[C@H]1c1ccc(OCC(=O)N/N=C\c2cc(Cl)cc(Cl)c2O)c(OC)c1 |
| InChI | InChI=1S/C23H22Cl2N4O7/c1-11-19(22(32)35-3)20(28-23(33)27-11)12-4-5-16(17(7-12)34-2)36-10-18(30)29-26-9-13-6-14(24)8-15(25)21(13)31/h4-9,20,31H,10H2,1-3H3,(H,29,30)(H2,27,28,33)/b26-9-/t20-/m0/s1 |
| InChIKey | IBIGZBGFJLAVBO-ISUAAFSHSA-N |
| XLogP | 3.04 |
| TPSA | 147.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|