C24H24IN5O9 — CID 137139178
ethyl (4R)-4-[4-[2-[(2Z)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137139178) has the molecular formula C24H24IN5O9 and a molecular weight of 653.39 g/mol. Its IUPAC name is ethyl (4R)-4-[4-[2-[(2Z)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-4-[4-[2-[(2Z)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137139178 |
| Molecular Formula | C24H24IN5O9 |
| Molecular Weight | 653.39 g/mol |
| Exact Mass | 653.06 |
| IUPAC Name | ethyl (4R)-4-[4-[2-[(2Z)-2-[(4-hydroxy-3-iodo-5-nitrophenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=O)N[C@@H]1c1ccc(OCC(=O)N/N=C\c2cc(I)c(O)c([N+](=O)[O-])c2)c(OC)c1 |
| InChI | InChI=1S/C24H24IN5O9/c1-4-38-23(33)20-12(2)27-24(34)28-21(20)14-5-6-17(18(9-14)37-3)39-11-19(31)29-26-10-13-7-15(25)22(32)16(8-13)30(35)36/h5-10,21,32H,4,11H2,1-3H3,(H,29,31)(H2,27,28,34)/b26-10-/t21-/m1/s1 |
| InChIKey | SOQSSLFVSFRPLD-RNBGMOGSSA-N |
| XLogP | 2.63 |
| TPSA | 190.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|