C29H34N4O8 — CID 137079737
ethyl (4S)-4-[4-[2-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137079737) has the molecular formula C29H34N4O8 and a molecular weight of 566.61 g/mol. Its IUPAC name is ethyl (4S)-4-[4-[2-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-4-[4-[2-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137079737 |
| Molecular Formula | C29H34N4O8 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | ethyl (4S)-4-[4-[2-[(2Z)-2-[(3-ethoxy-4-hydroxy-5-prop-2-enylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | C=CCc1cc(/C=N\NC(=O)COc2ccc([C@@H]3NC(=O)NC(C)=C3C(=O)OCC)cc2OC)cc(OCC)c1O |
| InChI | InChI=1S/C29H34N4O8/c1-6-9-20-12-18(13-23(27(20)35)39-7-2)15-30-33-24(34)16-41-21-11-10-19(14-22(21)38-5)26-25(28(36)40-8-3)17(4)31-29(37)32-26/h6,10-15,26,35H,1,7-9,16H2,2-5H3,(H,33,34)(H2,31,32,37)/b30-15-/t26-/m0/s1 |
| InChIKey | VLZGIOCRRYLFJR-GRXZTXSZSA-N |
| XLogP | 3.25 |
| TPSA | 156.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|