C30H30N6O7 — CID 137079735
ethyl (4R)-4-[4-[2-[(2Z)-2-[(2-hydroxy-5-phenyldiazenylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137079735) has the molecular formula C30H30N6O7 and a molecular weight of 586.61 g/mol. Its IUPAC name is ethyl (4R)-4-[4-[2-[(2Z)-2-[(2-hydroxy-5-phenyldiazenylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-4-[4-[2-[(2Z)-2-[(2-hydroxy-5-phenyldiazenylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137079735 |
| Molecular Formula | C30H30N6O7 |
| Molecular Weight | 586.61 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | ethyl (4R)-4-[4-[2-[(2Z)-2-[(2-hydroxy-5-phenyldiazenylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=O)N[C@@H]1c1ccc(OCC(=O)N/N=C\c2cc(/N=N/c3ccccc3)ccc2O)c(OC)c1 |
| InChI | InChI=1S/C30H30N6O7/c1-4-42-29(39)27-18(2)32-30(40)33-28(27)19-10-13-24(25(15-19)41-3)43-17-26(38)36-31-16-20-14-22(11-12-23(20)37)35-34-21-8-6-5-7-9-21/h5-16,28,37H,4,17H2,1-3H3,(H,36,38)(H2,32,33,40)/b31-16-,35-34+/t28-/m1/s1 |
| InChIKey | VLNCSMTWBBFFDQ-MKFKQTBZSA-N |
| XLogP | 4.54 |
| TPSA | 172.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|