C25H28N4O8 — CID 137037231
ethyl (4S)-4-[4-[2-[(2Z)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137037231) has the molecular formula C25H28N4O8 and a molecular weight of 512.52 g/mol. Its IUPAC name is ethyl (4S)-4-[4-[2-[(2Z)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4S)-4-[4-[2-[(2Z)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137037231 |
| Molecular Formula | C25H28N4O8 |
| Molecular Weight | 512.52 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | ethyl (4S)-4-[4-[2-[(2Z)-2-[(2-hydroxy-3-methoxyphenyl)methylidene]hydrazinyl]-2-oxoethoxy]-3-methoxyphenyl]-6-methyl-2-oxo-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=O)N[C@H]1c1ccc(OCC(=O)N/N=C\c2cccc(OC)c2O)c(OC)c1 |
| InChI | InChI=1S/C25H28N4O8/c1-5-36-24(32)21-14(2)27-25(33)28-22(21)15-9-10-17(19(11-15)35-4)37-13-20(30)29-26-12-16-7-6-8-18(34-3)23(16)31/h6-12,22,31H,5,13H2,1-4H3,(H,29,30)(H2,27,28,33)/b26-12-/t22-/m0/s1 |
| InChIKey | MPTGPYDAVFUDHQ-GMMBANTPSA-N |
| XLogP | 2.13 |
| TPSA | 156.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|