C27H30N4O6S — CID 137079431
ethyl (4R)-4-[2-[2-[2-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate (PubChem CID 137079431) has the molecular formula C27H30N4O6S and a molecular weight of 538.63 g/mol. Its IUPAC name is ethyl (4R)-4-[2-[2-[2-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl (4R)-4-[2-[2-[2-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 137079431 |
| Molecular Formula | C27H30N4O6S |
| Molecular Weight | 538.63 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | ethyl (4R)-4-[2-[2-[2-[(4-hydroxy-3-methoxy-5-prop-2-enylphenyl)methylidene]hydrazinyl]-2-oxoethoxy]phenyl]-6-methyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidine-5-carboxylate |
| SMILES | C=CCc1cc(C=NNC(=O)COc2ccccc2[C@H]2NC(=S)NC(C)=C2C(=O)OCC)cc(OC)c1O |
| InChI | InChI=1S/C27H30N4O6S/c1-5-9-18-12-17(13-21(35-4)25(18)33)14-28-31-22(32)15-37-20-11-8-7-10-19(20)24-23(26(34)36-6-2)16(3)29-27(38)30-24/h5,7-8,10-14,24,33H,1,6,9,15H2,2-4H3,(H,31,32)(H2,29,30,38)/t24-/m1/s1 |
| InChIKey | ZCCGJAWZMDYPDI-XMMPIXPASA-N |
| XLogP | 3.01 |
| TPSA | 130.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.63 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|